This compound is the dimeric form of the amino acid homocysteine. It is primarily used as a research reagent and biomarker for homocystinuria, particularly in studies related to cystathionine beta-synthase deficiency.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
HOMOCYSTINE, DL- 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
D-Homoserine
research compound
Hordenine hydrochloride
research compound for alkaloid studies
4-chloro-1H-pyrrolo[3,2-c]pyridine
research compound
3-Nitrophthalic acid
crystallographic research reagent
L-Homocystine
biochemical research reagent
4,4'-Dithiobis(2-aminobutyric acid)
research compound
(2R)-2-amino-4-[[(3R)-3-amino-3-carboxypropyl]disulfanyl]butanoic acid
ZTVZLYBCZNMWCF-PHDIDXHHSA-N
C(CSSCC[C@H](C(=O)O)N)[C@H](C(=O)O)N
HOMOCYSTINE, DL- 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.