3',5'-cyclic AMP is a 3',5'-cyclic purine nucleotide with adenine as the nucleobase. It functions as a metabolite in mice, Escherichia coli, and humans.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 60-92-4
Rp-cAMPS triethylammonium salt
research compound
Glycine hydrochloride
Buffer and reagent in organic chemistry
Methyl 3-chloropropanoate
research compound
Tert-Butyldiphenylphosphine
ligand for homogeneous catalysis
Di-tert-butylmethylphosphine
phosphine ligand for catalysis
8-Bromo-cAMP sodium salt
research compound
Bucladesine Calcium
research compound
Bucladesine sodium
phosphodiesterase inhibitor research tool
(4aR,6R,7R,7aS)-6-(6-aminopurin-9-yl)-2-hydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-7-ol
IVOMOUWHDPKRLL-KQYNXXCUSA-N
C1[C@@H]2[C@H]([C@H]([C@@H](O2)N3C=NC4=C(N=CN=C43)N)O)OP(=O)(O1)O