This compound is a chelating agent used primarily in industrial applications, including water treatment and detergent formulations, where it sequesters metal ions to prevent scale formation and stabilize solutions.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 5995-42-6
Lexidronam
chelating agent in detergents
에틸렌다이아민테트라아세트산
chelating agent for detergents and cleaners
2-mercaptoethanol
Reducing agent and chemical intermediate
다이에틸 에터
Solvent and reagent in organic syntheses
Hydrazine, methyl-
Rocket propellant and chemical intermediate
[2-hydroxyethyl(phosphonomethyl)amino]methylphosphonic acid
YAWYUSRBDMEKHZ-UHFFFAOYSA-N
C(CO)N(CP(=O)(O)O)CP(=O)(O)O