This compound is a sulfonium salt used as a cationic photoinitiator, typically supplied as the hexafluorophosphate salt. It is designed to initiate cationic polymerization upon exposure to ultraviolet light, making it significant in UV-curable coatings and inks.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 591773-92-1
Triphenylsulfonium hexafluorophosphate
Cationic photoinitiator
1-HEXENE
Chemical intermediate and comonomer
2-Bromoethyl ethyl ether
chemical intermediate and insecticide precursor
1-HEPTENE
Organic synthesis intermediate
3-Hexadecanol
secondary fatty alcohol
10-(4-phenylphenyl)-2-propan-2-ylthioxanthen-10-ium-9-one hexafluorophosphate
UHKYZKDZFIFLBK-UHFFFAOYSA-N
CC(C)C1=CC2=C(C=C1)[S+](C3=CC=CC=C3C2=O)C4=CC=C(C=C4)C5=CC=CC=C5.F[P-](F)(F)(F)(F)F