1-Iodopropane-d7 is a deuterated research compound, specifically the heptadeuterated form of 1-iodopropane where all seven hydrogen atoms are replaced with deuterium. It is primarily used as a laboratory reagent in chemical and pharmaceutical research involving isotopic labeling.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 59012-23-6
4-(Hydroxymethyl)benzeneboronic Acid
research reagent
3-iodo-2-(trifluoromethyl)pyridine
research compound
Potassium 1,2-naphthoquinone-4-sulphonate
analytical reagent
1-BROMO-3-IODOBENZENE
research compound
1-IODOPROPANE
Solvent and organic synthesis intermediate
Propane-1,1-d2, 1-iodo-
isotopically labeled research compound
1,1,1,2,2,3,3-heptadeuterio-3-iodopropane
PVWOIHVRPOBWPI-NCKGIQLSSA-N
[2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])I