4'-Hydroxy-4-biphenylcarboxylic acid is a research compound. It is a chemical intermediate related to the synthesis of SB-245570, a substance previously investigated as a serotonin 5-HT1B receptor antagonist for research on major depressive disorder, though it was never commercialized.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 58574-03-1
4-hydroxybenzoic acid
intermediate for food preservatives
[1,1'-Biphenyl]-4,4'-dicarboxylic acid
Pharmaceutical intermediate
[1,1'-Biphenyl]-4,4'-dicarboxylic acid
Pharmaceutical intermediate
1-(4-Methylphenyl)ethylamine
Pharmaceutical intermediate or research compound
4-Bromobenzoic acid
analytical reagent for strontium detection
4-Bromo-N,N-dimethylaniline
research compound
2-PYRIDINEMETHANOL
research reagent
4-(4-hydroxyphenyl)benzoic acid
JTGCXYYDAVPSFD-UHFFFAOYSA-N
C1=CC(=CC=C1C2=CC=C(C=C2)O)C(=O)O