This compound is a protected amino acid intermediate, specifically the tert-butyl ester and O-tert-butyl ether derivative of L-threonine, presented as an acetic acid salt. It is primarily used in peptide synthesis as a building block for introducing threonine residues with protected side chains.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 5854-77-3
1,2-DI-TERT-BUTYL (2S,4S)-4-HYDROXYPYRROLIDINE-1,2-DICARBOXYLATE
Protected amino acid intermediate
N-Boc-glycine Methyl Ester
Protected amino acid intermediate
Z-TYR(TBU)-OME
Protected amino acid intermediate
2-{[(tert-butoxy)carbonyl]amino}-2-(3-chlorophenyl)acetic acid
Protected amino acid intermediate
(S)-(+)-2-Amino-1-butanol
pharmaceutical intermediate
2,2-Dimethylbutyryl chloride
Pharmaceutical intermediate for synthesis
Ethyl 2,6-dichloronicotinate
Pharmaceutical and agrochemical intermediate
(s)-3-aminobutanoic acid hydrochloride
GABA analogue intermediate
acetic acid;tert-butyl (2S,3R)-2-amino-3-[(2-methylpropan-2-yl)oxy]butanoate
BGAUVMFJRASONL-RJUBDTSPSA-N
C[C@H]([C@@H](C(=O)OC(C)(C)C)N)OC(C)(C)C.CC(=O)O