Methyl olivetolate is a chemical compound used as a pharmaceutical intermediate. It features a pentyl-substituted aromatic ring with hydroxyl groups and an ester functional group, contributing to its role in chemical synthesis for pharmaceutical manufacturing.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 58016-28-7
Ethyl 2,4-dihydroxy-6-pentylbenzoate
Lisdexamfetamine intermediate
6-Amino-5-ethyl-5-phenyl-2,4(3H,5H)-pyrimidinedione
Pharmaceutical impurity reference standard
2-Naphthylacetic acid
pharmaceutical intermediate
Tert-Butyl 1-amino-3,6,9,12-tetraoxapentadecan-15-oate
Polyethylene glycol linker for bioconjugation
1-(4-(3-Chloropropoxy)-3-methoxyphenyl)ethanone
Iloperidone intermediate
methyl 2,4-dihydroxy-6-pentylbenzoate
RQGAOBDPFOADCM-UHFFFAOYSA-N
CCCCCC1=C(C(=CC(=C1)O)O)C(=O)OC