meso-Hydrobenzoin is a chemical compound with two alcohol groups and two aromatic rings, commonly used as a research compound in laboratory settings. Its structure features defined stereochemistry, and it is primarily supplied for research and development purposes.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Meso-Hydrobenzoin 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
2-Methylpyridine-4-boronic acid
Boronic acid research reagent
ACEQUINOCYL-HYDROXY
reference standard
6-Amino-2,3-dimethylpyridine
research compound for chemical synthesis
4,4,4-trifluoro-1-(3-methoxyphenyl)-1,3-butanedione
research compound
(1S,2S)-1,2-diphenylethane-1,2-diol
Pharmaceutical intermediate
(1R,2R)-1,2-diphenylethane-1,2-diol
pharmaceutical intermediate
(1R,2S)-(-)-2-Amino-1,2-diphenylethanol
Intermediates for chiral pharmaceutical synthesis
(1S,2R)-(+)-2-Amino-1,2-diphenylethanol
research compound
(1R,2S)-1,2-diphenylethane-1,2-diol
IHPDTPWNFBQHEB-OKILXGFUSA-N
C1=CC=C(C=C1)[C@H]([C@H](C2=CC=CC=C2)O)O
Meso-Hydrobenzoin 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.