Acetophenone, 2-phenyl-, oxime is an organic compound featuring an oxime functional group attached to a diphenylethanone backbone, with two aromatic rings. It is primarily used as a research reagent in laboratory settings.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Acetophenone, 2-phenyl-, oxime 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Acetophenone, 2-phenyl-, oxime
research compound
N-(6-methoxyquinolin-8-yl)hydroxylamine
research compound
3-deuterioindole
deuterated indole research compound
4-(2-(tert-Butoxycarbonyl)hydrazine-1-carbonyl)pyridine 1-oxide
research compound
3'-chloro-4'-fluoro-[1,1'-biphenyl]-2-amine
research intermediate
(NZ)-N-(1,2-diphenylethylidene)hydroxylamine
PWCUVRROUAKTLL-PFONDFGASA-N
C1=CC=C(C=C1)C/C(=N/O)/C2=CC=CC=C2
Acetophenone, 2-phenyl-, oxime 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.