Ethyl 3-amino-2-methylbenzoate is a chemical compound used as a pharmaceutical intermediate. It features an aromatic ring with an amine and an ester functional group, making it suitable for further synthetic transformations in drug manufacturing.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 57414-85-4
Benzyl Dimethylphosphonoacetate
Pharmaceutical intermediate
(3-Iodophenyl)methanol
Pharmaceutical intermediate for organic synthesis
4-Chloro-2-methoxybenzoic acid
pharmaceutical intermediate
Methyl (2-chlorophenyl)acetate
Pharmaceutical intermediate for drug synthesis
ethyl 3-amino-2-methylbenzoate
RZDRJEHTKWQFQO-UHFFFAOYSA-N
CCOC(=O)C1=C(C(=CC=C1)N)C