1H-Imidazole-4,5-dicarboxylic acid is a chemical compound used as a research reagent, particularly for the synthesis and study of imidazole derivatives. Its structure features an imidazole ring with two carboxylic acid groups, giving it moderate polarity and hydrogen-bonding capacity.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 570-22-9
N-([1,1'-Biphenyl]-4-yl)-[1,1'-biphenyl]-3-amine
TAAR1 agonist research compound
Ethyl 1-(3-chloro-5-((4-(4-chlorothiophen-2-yl)-5-(4-cyclohexylpiperazin-1-yl)thiazol-2-yl)carbamoyl)pyridin-2-yl)piperidine-4-carboxylate
research compound
Dichlorodehydroabietic acid
Reference standard for abietic acid impurity
4-Maleimidobutyric acid
Crosslinking reagent for bioconjugation
1H-imidazole-4,5-dicarboxylic acid
ZEVWQFWTGHFIDH-UHFFFAOYSA-N
C1=NC(=C(N1)C(=O)O)C(=O)O