Alpha-Methyl-D-Tryptophan is a research compound structurally related to the amino acid tryptophan, which is involved in protein biosynthesis and serves as a precursor to serotonin, melatonin, and niacin. This derivative is primarily used in laboratory studies to investigate tryptophan metabolism and related biochemical pathways.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 56452-52-9
Furo[3,2-b]pyridine-5-carboxylic acid
research compound
3-aminothiophene-2-carbonitrile
research compound
1,1-dimethyl-2-(4-methoxyphenyl)ethylamine hydrochloride
pharmaceutical research intermediate
1-(4-methoxyphenyl)-2-methylpropan-2-amine
research compound
Alpha-Methyl-L-tryptophan
research compound for tryptophan metabolism studies
(2R)-2-amino-3-(1H-indol-3-yl)-2-methylpropanoic acid
ZTTWHZHBPDYSQB-GFCCVEGCSA-N
C[C@@](CC1=CNC2=CC=CC=C21)(C(=O)O)N