2H-Hexafluoro(2-methylpropanoic acid) is a fluorinated organic acid used as a research reagent. It is also known as This compound and features a carboxylic acid group with multiple fluorine substituents.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 564-10-3
N,N-Diethyl-L-alaninamide
Research compound reference standard
SOPC
phospholipid biochemical research reagent
Benzoic acid, 5-chloro-2-methyl-, ethyl ester
research compound
(2S)-3,3-dimethyl-2-(4,5,6,7-tetrafluoro-1,3-dioxoisoindol-2-yl)butanoic acid;ethyl acetate;rhodium
Rhodium catalyst for organic synthesis
3,3,3-trifluoro-2-(trifluoromethyl)propanoic acid
RAEAYTICAPHWJW-UHFFFAOYSA-N
C(C(=O)O)(C(F)(F)F)C(F)(F)F