(2H10)-o-Xylene is a fully deuterated analog of o-xylene used as an internal standard or tracer in analytical research. Its structure consists of a benzene ring with ten hydrogen atoms replaced by deuterium, making it valuable for mass spectrometry and nuclear magnetic resonance studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
(2H10)-o-Xylene 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
(3-tert-Butylphenyl)boronic acid
Research reagent for organic synthesis
3-BROMO-7-METHYLIMIDAZO[1,2-A]PYRIDINE
research compound
5-BROMO-2-ETHYLPHENOL
Research chemical
6,6-Dimethyl-5,7-dioxaspiro[2.5]octane-4,8-dione
research compound
O-XYLENE
solvent and chemical intermediate
1,2-bis(trideuteriomethyl)benzene
isotopically labeled research compound
(2H10)-o-Xylene(CAS 56004-61-6)의 국제 HS 코드는 2845.90입니다.
2845.90
2845 90 10
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
1,2,3,4-tetradeuterio-5,6-bis(trideuteriomethyl)benzene
CTQNGGLPUBDAKN-ZGYYUIRESA-N
[2H]C1=C(C(=C(C(=C1[2H])C([2H])([2H])[2H])C([2H])([2H])[2H])[2H])[2H]
(2H10)-o-Xylene 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.