This compound is a polyethylene glycol-based research reagent featuring a fluorenylmethoxycarbonyl (Fmoc) protecting group and a terminal carboxylic acid. It is designed for applications in bioconjugation and peptide synthesis, where it serves as a hydrophilic linker.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
1-(9H-Fluoren-9-ylmethyl) 5,8,11,14,17,20,23,26-octaoxa-2-azanonacosanedioate
Pharmaceutical intermediate for PEGylation
(Fmoc-amino)-PEG6-carboxylic Acid
PEG-based intermediate for conjugation
3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)propanoic acid
Fmoc-protected amino acid building block
3-[2-[2-[2-[2-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid
research compound for conjugation
2,3,4,5-TETRAFLUOROANILINE
Organic synthesis building block
Trideuteriomethanamine
deuterated research reagent
5-Bromo-2-ethoxypyridine
research compound
4-Acetoxyindole
Research compound for indole chemistry
3-[2-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid
NUHRPLKTAAVHCZ-UHFFFAOYSA-N
C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCOCCOCCOCCOCCC(=O)O
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.