Alverine citrate is a salt form of alverine, a compound used as a pharmaceutical raw material. It functions as a smooth muscle relaxant, affecting involuntary muscles in the gastrointestinal tract.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 5560-59-8
N-Phenylpropyl Alverine Hydrochloride
smooth muscle relaxant drug
3-Phenyl-N,N-bis(3-phenylpropyl)propan-1-amine
research compound
Tandetoron
pharmaceutical active ingredient
Nimustine hydrochloride
active pharmaceutical ingredient
Lumbokinase capsules
active pharmaceutical ingredient
Cephalonium
veterinary cephalosporin antibiotic
Alverine Impurity 19
nitrosamine reference standard
N-ethyl-3-phenyl-N-(3-phenylpropyl)propan-1-amine;2-hydroxypropane-1,2,3-tricarboxylic acid
RYHCACJBKCOBTJ-UHFFFAOYSA-N
CCN(CCCC1=CC=CC=C1)CCCC2=CC=CC=C2.C(C(=O)O)C(CC(=O)O)(C(=O)O)O