This compound is an organic molecule featuring a pyridine ring and a dimethylamino group connected by an unsaturated carbon chain. It is primarily recognized as a pharmaceutical intermediate used in chemical synthesis and manufacturing.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 55314-16-4
5-aminopyridine-2-carbonitrile
pharmaceutical intermediate
9-Bromo-1-nonanol
Pharmaceutical intermediate for fulvestrant synthesis
3-(1-Cyanoethyl)benzoic acid
pharmaceutical intermediate
2-Acetoxybenzoyl chloride
Pharmaceutical intermediate for API synthesis
(E)-3-(dimethylamino)-1-pyridin-3-ylprop-2-en-1-one
MZLRFUCMBQWLNV-FNORWQNLSA-N
CN(C)/C=C/C(=O)C1=CN=CC=C1