Citrulline malate is a salt combination of the amino acid citrulline and malic acid. It is recognized as a nutritional ingredient used for its potential anti-fatigue properties.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 54940-97-5
Citrulline malate
anti-fatigue compound
L-citrulline
nutritional supplementation
L-Homocitrulline
research compound
Psicopyranose
functional sugar
Glycerol trimyristate
Food ingredient from natural oils
Guanosine 5'-monophosphate disodium salt
flavor enhancer food additive
Acesulfame potassium
Artificial sweetener
(2R)-2-amino-5-(carbamoylamino)pentanoic acid
Research compound
(2S)-2-amino-5-(carbamoylamino)pentanoic acid;2-hydroxybutanedioic acid
DROVUXYZTXCEBX-WCCKRBBISA-N
C(C[C@@H](C(=O)O)N)CNC(=O)N.C(C(C(=O)O)O)C(=O)O