[1,1'-Biphenyl]-4-ylmethyl acrylate is a research compound used primarily in laboratory and manufacturing settings. It features an ester functional group linking an acrylate moiety to a biphenyl ring system, imparting moderate lipophilicity and low polarity.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 54140-58-8
Benzyl acrylate
polymerization monomer for acrylic resins
1,3,7-Trimethyluric acid
research compound
2-Hydroxy-5-nitropyridine
research compound
6-chloro-N-methylnicotinamide
research compound
3-oxopentanedioic acid
organic synthesis intermediate
(4-phenylphenyl)methyl prop-2-enoate
QBECDXJGYFRACA-UHFFFAOYSA-N
C=CC(=O)OCC1=CC=C(C=C1)C2=CC=CC=C2