Di-tert-butyl malonate is a chemical compound used primarily as a pharmaceutical intermediate. It serves as a building block in the synthesis of various active pharmaceutical ingredients and research compounds.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Di-tert-butyl malonate 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Tert-Butyl methyl malonate
research compound
Tert-butyl acetoacetate
Chemical intermediate
Mono-tert-Butyl malonate
Pharmaceutical intermediate
Tert-Butyl ethyl malonate
Chemical intermediate for organic synthesis
3,3-Dimethylacrylic acid
pharmaceutical intermediate
3-Aminobutanoic acid
peptide building block intermediate
1H-Pyrrole-2,5-dione
Pharmaceutical intermediate and research reagent
(5,6-Dichloropyridin-3-yl)methanol
pharmaceutical intermediate
ditert-butyl propanedioate
CLPHAYNBNTVRDI-UHFFFAOYSA-N
CC(C)(C)OC(=O)CC(=O)OC(C)(C)C
Di-tert-butyl malonate 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.