This compound is a deuterium-labeled derivative of estradiol, specifically deuterated at the 2 and 4 positions of the aromatic ring. It is primarily used as a research reagent for analytical studies, such as tracing metabolic pathways or quantification in biological samples.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2,4-Dideuterioestradiol 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
(16beta,17beta)-Estra-1,3,5(10)-triene-2,4-D2-3,16,17-triol
Deuterated steroid research standard
Estrone-2,4,16,16-d4
stable isotope labeled research reagent
4'-Chloroacetanilide
Research chemical
Ethyl 3-bromopropanoate
research compound
[(2s)-1-benzylpyrrolidin-2-yl]methanol
research compound
17alpha-Estradiol
active pharmaceutical ingredient
17beta-Estradiol-16,16,17-d3
Deuterated internal standard compound
17ALPHA-ESTRADIOL-2,4-D2
deuterated reference standard
(8R,9S,13S,14S,17S)-2,4-dideuterio-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol
VOXZDWNPVJITMN-JXCLBMSPSA-N
[2H]C1=CC2=C(CC[C@@H]3[C@@H]2CC[C@]4([C@H]3CC[C@@H]4O)C)C(=C1O)[2H]
2,4-Dideuterioestradiol 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.