Tinuvin 770 is a hindered amine light stabilizer (HALS) used to protect plastics and coatings from oxidation caused by sunlight exposure. Its active form functions as an aminoxyl radical, which scavenges free radicals to prevent polymer degradation.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 52829-07-9
O-Tolunitrile
Chemical intermediate for synthesis
3-Ethyl-4-methylpyridine
chemical intermediate
1-TETRALONE
Solvent and chemical intermediate
Tert-Butyl bromoacetate
Chemical synthesis intermediate
Decanedioic acid, 1,10-bis(1,2,2,6,6-pentamethyl-4-piperidinyl) ester, mixt. with 1-methyl 10-(1,2,2,6,6-pentamethyl-4-piperidinyl) decanedioate
hindered amine light stabilizer
Bis(1,2,2,6,6-pentamethyl-4-piperidyl) sebacate
UV stabilizer
bis(2,2,6,6-tetramethylpiperidin-4-yl) decanedioate
XITRBUPOXXBIJN-UHFFFAOYSA-N
CC1(CC(CC(N1)(C)C)OC(=O)CCCCCCCCC(=O)OC2CC(NC(C2)(C)C)(C)C)C