This compound is a research reagent primarily used in laboratory settings for chemical and biological studies. It features an aromatic ring and polar functional groups, indicating potential utility in synthetic chemistry and molecular investigations.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 518047-98-8
Tris(2-carboxyethyl)phosphine hydrochloride
reducing agent in biochemistry
9,10-Dibromoanthracene-d8
deuterated research compound
5-Hydroxy-2-methoxypyridine
research compound
(R)-2-Amino-3-chloropropanoic acid hydrochloride
Research compound for biochemical studies
benzyl N-[(1Z)-1-amino-1-hydroxyimino-2-methylpropan-2-yl]carbamate
WWSJZCLRWHEHPA-UHFFFAOYSA-N
CC(C)(/C(=N/O)/N)NC(=O)OCC1=CC=CC=C1
—