Nimesulide Impurity F is a chemical compound used as a reference standard in pharmaceutical quality control. Its structure contains sulfonamide and nitroaromatic groups, making it a key marker for purity analysis of nimesulide.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 51765-72-1
Phenyl N-phenylphosphoramidochloridate
phosphorylating agent for enzyme inactivation
(6R,7R)-7-amino-3-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid
Cephalosporin antibiotic intermediate
3-Fluoro-5-methylbenzoic acid
Pharmaceutical intermediate
(2-Fluorobenzyl)hydrazine
Pharmaceutical intermediate
N-methylsulfonyl-N-(4-nitro-2-phenoxyphenyl)methanesulfonamide
DGTALLPFLVLCNQ-UHFFFAOYSA-N
CS(=O)(=O)N(C1=C(C=C(C=C1)[N+](=O)[O-])OC2=CC=CC=C2)S(=O)(=O)C