This compound is an organic compound used primarily as a fragrance ingredient. It is a long-chain unsaturated aldehyde with a molecular structure that includes multiple methyl branches and a terminal aldehyde group.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
6,10-Dodecadienal, 3,7,11-trimethyl-, (6E)- 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
3,7-Dimethyloct-6-enal
Fragrance and flavor ingredient
Citronellyl nitrile
Fragrance ingredient
3-(Methylthio)-1-hexanol
Flavor and fragrance ingredient
2,4,6-Trimethyl-4-phenyl-1,3-dioxane
fragrance ingredient
O-Tolyl acetate
Flavor and fragrance ingredient
(3s,6e)-3,7,11-trimethyl-6,10-dodecadienal
flavor and fragrance ingredient
(6E)-3,7,11-trimethyldodeca-6,10-dienal
ITBYWGRSPHMAEE-NTEUORMPSA-N
CC(CC/C=C(\C)/CCC=C(C)C)CC=O
6,10-Dodecadienal, 3,7,11-trimethyl-, (6E)- 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.