아비에트산
Abietic acid is a diterpenoid naturally occurring in coniferous trees, where it is believed to play a role in defending the plant against insects and wounds. It is a chiral, tricyclic molecule containing two alkene groups and a carboxylic acid functional group.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
ABIETIC ACID 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
1,1'-(Pentane-1,5-diyl)bis(1-methylpyrrolidinium) dibromide
Structure directing agent for zeolites
Sodium benzenesulfonate
Detergent and anionic surfactant
5,6,7,8-tetrahydronaphthalene-2-carbaldehyde
chemical intermediate for synthesis
9,10-Bis(phenylethynyl)-2-methylanthracene
Fluorescent dye and probe
ABIETIC ACID(CAS 514-10-3)의 국제 HS 코드는 3806.10입니다.
3806.10
3806 10 00
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
(1R,4aR,4bR,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carboxylic acid
RSWGJHLUYNHPMX-ONCXSQPRSA-N
CC(C)C1=CC2=CC[C@@H]3[C@@]([C@H]2CC1)(CCC[C@@]3(C)C(=O)O)C
ABIETIC ACID 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.