아비에트산
Abietic acid is a diterpenoid naturally occurring in coniferous trees, where it is believed to play a role in defending the plant against insects and wounds. It is a chiral, tricyclic molecule containing two alkene groups and a carboxylic acid functional group.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 514-10-3
1,1'-(Pentane-1,5-diyl)bis(1-methylpyrrolidinium) dibromide
Structure directing agent for zeolites
Sodium benzenesulfonate
Detergent and anionic surfactant
5,6,7,8-tetrahydronaphthalene-2-carbaldehyde
chemical intermediate for synthesis
9,10-Bis(phenylethynyl)-2-methylanthracene
Fluorescent dye and probe
(1R,4aR,4bR,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carboxylic acid
RSWGJHLUYNHPMX-ONCXSQPRSA-N
CC(C)C1=CC2=CC[C@@H]3[C@@]([C@H]2CC1)(CCC[C@@]3(C)C(=O)O)C