This compound is a chemical compound containing a benzodiazepine core structure, featuring amide and amine functional groups along with an aromatic halogen atom. It is primarily recognized as an intermediate in the synthesis of pharmaceutical compounds.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 50892-62-1
1-Chloroethyl chloroformate
Pharmaceutical intermediate for synthesis
3-(bromomethyl)benzamide
Pharmaceutical intermediate
4-(5-Methyl-3-phenyl-1,2-oxazol-4-yl)benzene-1-sulfonyl chloride
Pharmaceutical intermediate for valdecoxib synthesis
Ambroxol impurity c
Pharmaceutical reference standard impurity
8-Chloro-5,10-dihydro-5-nitroso-11H-dibenzo[b,e][1,4]diazepin-11-one
Nitroso impurity reference standard
3-chloro-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one
YVWNDABPZGGQFE-UHFFFAOYSA-N
C1=CC=C2C(=C1)C(=O)NC3=C(N2)C=CC(=C3)Cl