5-Acetamido-2-aminobenzoic acid is a chemical compound used as a pharmaceutical intermediate. It features an aromatic ring with an amino group and a carboxylic acid group, and is commonly employed in the synthesis of active pharmaceutical ingredients.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
5-Acetamido-2-aminobenzoic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
L-Cysteine, N-[(1,1-dimethylethoxy)carbonyl]-S-(phenylmethyl)-
Protected amino acid for peptide synthesis
Z-TYR(TBU)-OME
Protected amino acid intermediate
Bis(4-nitrophenyl) carbonate
pharmaceutical intermediate
6-Isopropylchromone-3-carbonitrile
pharmaceutical intermediate
5-Acetamido-2-aminobenzoic acid(CAS 50670-83-2)의 국제 HS 코드는 2924.29입니다.
2924.29
2924 29 70
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
5-acetamido-2-aminobenzoic acid
GSOHXJQXAKNJES-UHFFFAOYSA-N
CC(=O)NC1=CC(=C(C=C1)N)C(=O)O
5-Acetamido-2-aminobenzoic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.