1-bromo-3-fluorobenzene-D4 is a deuterated research compound featuring a benzene ring substituted with bromine and fluorine atoms, with all four hydrogen atoms replaced by deuterium. It is primarily used as a labeled reagent in analytical and synthetic chemistry studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
1-bromo-3-fluorobenzene-D4 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
2-BROMOFLUOROBENZENE-D4
deuterated research reference compound
1-Benzyl-3-piperidone Hydrochloride
research compound
2-Bromo-4-butanolide
research compound
5a(2)-O-Phosphonoadenylyl-(3a(2)a5a(2))-guanosine
RNA dinucleotide research reagent
1-BROMO-3-FLUOROBENZENE
pharmaceutical and agrochemical intermediate
1-bromo-2,3,4,6-tetradeuterio-5-fluorobenzene
QDFKKJYEIFBEFC-RHQRLBAQSA-N
[2H]C1=C(C(=C(C(=C1[2H])Br)[2H])F)[2H]
1-bromo-3-fluorobenzene-D4 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.