2,5-Dichlorobenzoic acid is a chlorinated derivative of benzoic acid that typically appears as white needles or powder. It is primarily used as a chemical intermediate in organic synthesis.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 50-79-3
2-Hydroxy-p-toluic acid
chemical intermediate for synthesis
3-Pyridinecarboxaldehyde
Chemical intermediate for synthesis
3-Fluorobenzyl cyanide
organic synthesis intermediate
CYCLOHEPTANOL
industrial solvent and chemical intermediate
2,5-dichlorobenzoic acid
QVTQYSFCFOGITD-UHFFFAOYSA-N
C1=CC(=C(C=C1Cl)C(=O)O)Cl