4,4',4''-Trimethoxytrityl chloride is a chemical compound used as a protecting group reagent for alcohols in organic synthesis. It features a trityl core with three methoxy substituents, providing stability and selectivity for protecting hydroxyl groups during complex molecule assembly.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
4,4',4''-Trimethoxytrityl chloride 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
P-(Chlorodiphenylmethyl)anisole
Pharmaceutical intermediate for oligonucleotide synthesis
1,1'-(Chlorophenylmethylene)bis(4-methoxybenzene)
protecting group reagent
Trityl chloride
Protecting group reagent for alcohols
Tert-Butyl 1H-imidazole-1-carboxylate
synthetic intermediate for Boc protection
Nipecotic acid
GABA reuptake inhibitor
4-Hydroxy-3-methylbenzoic acid
human blood serum metabolite research
Pyridine-2,4-dicarboxylic acid
enzyme inhibitor research compound
4,4',4''-Trimethoxytrityl chloride(CAS 49757-42-8)의 국제 HS 코드는 2909.30입니다.
2909.30
2909 30 90
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
1-[chloro-bis(4-methoxyphenyl)methyl]-4-methoxybenzene
OBFCMKPFILBCSQ-UHFFFAOYSA-N
COC1=CC=C(C=C1)C(C2=CC=C(C=C2)OC)(C3=CC=C(C=C3)OC)Cl
—
4,4',4''-Trimethoxytrityl chloride 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.