This compound is a substituted benzoxazine dicarboxylate used as a pharmaceutical intermediate in the synthesis of amlodipine analogues. It features a complex polycyclic structure with ester, amine, and ether functional groups, making it a key building block for calcium channel blocker derivatives.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
(2S)-2-amino-2-cyclopropylacetic acid
Pharmaceutical intermediate
2-Chloronicotinoyl chloride
pharmaceutical synthetic intermediate
Trientine tetrahydrochloride
Pharmaceutical intermediate
Tetraaminopyrimidine sulfate
Pharmaceutical intermediate for folic acid
5-O-ethyl 7-O-methyl 6-(2-chlorophenyl)-8-methyl-3,4,6,7-tetrahydro-2H-1,4-benzoxazine-5,7-dicarboxylate
ZTKBXGUJDFQQPS-UHFFFAOYSA-N
CCOC(=O)C1=C2C(=C(C(C1C3=CC=CC=C3Cl)C(=O)OC)C)OCCN2
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.