Mandyphos SL-M004-1 is a chiral ligand used in asymmetric catalysis, primarily employed as a research reagent. Its structure, derived from evidence, indicates a salt-like, multi-fragment organometallic compound containing iron, with features such as amine and ether functional groups and aromatic rings.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Mandyphos SL-M004-1 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
(S)-(+)-N,N-Dimethyl-1-((R)-2-(diphenylphosphino)ferrocenyl)ethylamine
chiral ligand for asymmetric catalysis
(R)-(-)-N,N-Dimethyl-1-((S)-2-(diphenylphosphino)ferrocenyl)ethylamine
chiral ligand for asymmetric catalysis
4,4'-Bi-1,3-benzodioxole-5,5'-diylbis(bis(4-methoxy-3,5-bis(2-methyl-2-propanyl)phenyl)phosphine)
chiral ligand for asymmetric catalysis
(1S)-1-(Diphenylphosphino)-2-[(1R)-1-(diphenylphosphino)ethyl]ferrocene
chiral ligand for asymmetric catalysis
(D-Lys16)-ACTH (1-24) (human, bovine, rat) trifluoroacetate salt
research reagent for receptor studies
2-fluoropyrazine
research compound
N-Hydroxybenzamide
analytical reagent and research compound
인돌린
research compound
HEJIDMKBSDYNOY-UHFFFAOYSA-N
CC1=CC(=CC(=C1OC)C)P([C]2[CH][CH][CH][C]2C(C3=CC=CC=C3)N(C)C)C4=CC(=C(C(=C4)C)OC)C.CC1=CC(=CC(=C1OC)C)P([C]2[CH][CH][CH][C]2C(C3=CC=CC=C3)N(C)C)C4=CC(=C(C(=C4)C)OC)C.[Fe]
Mandyphos SL-M004-1 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.