1-Adamantaneacetic acid is a chemical compound that serves as a pharmaceutical intermediate. It is commonly used in the manufacturing of various pharmaceutical products.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 4942-47-6
(S)-GNA-U-phosphoramidite
Phosphoramidite building block for oligonucleotide synthesis
Hippuric acid
Pharmaceutical intermediate for synthesis
Methyl 1-t-butoxycarbonyl-4-trifluoromethylpiperidine-4-carboxylate
pharmaceutical intermediate
4-amino-5-methoxy-N,2-dimethylbenzenesulfonamide
pharmaceutical intermediate
2-(1-adamantyl)acetic acid
AOTQGWFNFTVXNQ-UHFFFAOYSA-N
C1C2CC3CC1CC(C2)(C3)CC(=O)O