4-Hydroxy estrone 1-N3-Adenine (4-OHE1-1-N3Ade) is a 3-hydroxy steroid research compound. It has a complex structure containing multiple aromatic rings and heterocycles, and is used primarily in laboratory settings.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
4-Hydroxy estrone 1-N3-Adenine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
4-Hydroxy Estradiol 1-N3-Adenine
Research reagent for impurity analysis
6-chloro-4-methyl-7-azaindole
research compound
Glycine-2,2-d2
deuterated glycine research standard
(2H5)Glycine
deuterated reference standard for research
1,4'-Bipiperidine
research reagent
(8R,9S,13S,14S)-3,4-dihydroxy-1-(6-imino-7H-purin-3-yl)-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one
TYEPIVMWBGXYTG-RPRYFYCUSA-N
C[C@]12CC[C@H]3[C@H]([C@@H]1CCC2=O)CCC4=C3C(=CC(=C4O)O)N5C=NC(=N)C6=C5N=CN6
4-Hydroxy estrone 1-N3-Adenine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.