Pinoresinol is a tetrahydrofuran lignan found in plants such as Styrax species and Forsythia suspensa, as well as in the caterpillar of the cabbage butterfly Pieris rapae, where it acts as a defense compound against ants.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 487-36-5
Pinoresinol dimethyl ether
lignan
1,2-Pyrrolidinedicarboxylic acid, 4-cyano-, 1-(1,1-dimethylethyl) 2-methyl ester, (2S,4S)-
Pharmaceutical intermediate for Velpatasvir
4-(bromomethyl)-1,2-dihydroquinolin-2-one
Rebamipide intermediate
1,4'-Bipiperidine dihydrochloride
Pharmaceutical intermediate
3,5-Diamino-6-chloro-pyrazine acid
Intermediate for amiloride synthesis
4-[(3S,3aR,6S,6aR)-6-(4-hydroxy-3-methoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]-2-methoxyphenol
HGXBRUKMWQGOIE-AFHBHXEDSA-N
COC1=C(C=CC(=C1)[C@@H]2[C@H]3CO[C@@H]([C@H]3CO2)C4=CC(=C(C=C4)O)OC)O