This compound is an organic molecule featuring two vinyl-substituted aromatic rings connected by an ethylene bridge. It serves primarily as a monomer in polymer synthesis, enabling the formation of specialized polymeric materials.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Benzene, 1,1'-(1,2-ethanediyl)bis[4-ethenyl- 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
1-(tert-butoxy)-4-ethenylbenzene
monomer for polymer synthesis
4-Vinylbenzyl chloride
monomer for polymer synthesis
4-Vinylphenol
monomer for polymer synthesis
1,4-Butanediol diacrylate
monomer for polymer synthesis
1-CHLOROHEXADECANE
alkylating agent for organic synthesis
1,2,3,4-TETRAMETHYLBENZENE
solvent or chemical intermediate
Methyl 4-bromobutyrate
chemical intermediate for synthesis
Sodium 2-fluorobenzoate
research compound
1-ethenyl-4-[2-(4-ethenylphenyl)ethyl]benzene
ZXLAFQNTMMFLSA-UHFFFAOYSA-N
C=CC1=CC=C(C=C1)CCC2=CC=C(C=C2)C=C
Benzene, 1,1'-(1,2-ethanediyl)bis[4-ethenyl- 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.