This compound is a chemical intermediate used in the manufacturing of donepezil, a pharmaceutical agent. It features a dimethoxy-substituted indanone core linked to a pyridine ring.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 4803-74-1
4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl acetate
Pharmaceutical intermediate for synthesis
2-Amino-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide
Pharmaceutical intermediate for synthetic chemistry
(S)-(+)-2-Hydroxy-4-phthalimidobutyric Acid
pharmaceutical intermediate
N-(2'-Cyanobiphenyl-4-ylmethyl)-L-valine Methyl Ester Hydrochloride
Pharmaceutical intermediate for antihypertensive drugs
(2E)-5,6-dimethoxy-2-(pyridin-4-ylmethylidene)-3H-inden-1-one
SUVQWDLUAIFZKM-NTUHNPAUSA-N
COC1=C(C=C2C(=C1)C/C(=C\C3=CC=NC=C3)/C2=O)OC