This compound is a boronic acid derivative of an indole, featuring a tert-butyloxycarbonyl (Boc) protecting group and a bromine substituent. It is primarily used as a pharmaceutical intermediate in chemical synthesis, facilitating the construction of more complex molecules.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
(5-Bromo-1-(tert-butoxycarbonyl)-1H-indol-2-yl)boronic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Methyl 2-chloroacetoacetate
Pharmaceutical intermediate for synthesis
1-boc-3-cyanopyrrolidine
pharmaceutical intermediate
5-BROMO-2-IODO-3-METHOXYPYRAZINE
Pharmaceutical intermediate
Boc-Tyr(2-Br-Z)-OH
Protected amino acid for peptide synthesis
[5-bromo-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid
RBYTXZMVOGZESQ-UHFFFAOYSA-N
B(C1=CC2=C(N1C(=O)OC(C)(C)C)C=CC(=C2)Br)(O)O
(5-Bromo-1-(tert-butoxycarbonyl)-1H-indol-2-yl)boronic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.