Campesterin is a phytosterol compound found naturally in various plant oils such as rapeseed, soybean, and wheat germ oil. It is used as a food additive for its blood cholesterol-lowering properties.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 474-62-4
Cholesterol
emulsifying agent in pharmaceuticals and cosmetics
Cholenic acid
research compound
24(RS)-Hydroxycholesterol-d7
isotope-labeled research steroid standard
Glycocholic acid
Bile acid for fat absorption
Ellagic acid
antioxidant in cosmetics and nutraceuticals
Chlorophyll a
natural green colorant for food
N(alpha)-Lauroylarginine ethyl ester
antimicrobial surfactant
Cholesterol-26,26,26,27,27,27-d6
deuterated cholesterol internal standard
(3S,8S,9S,10R,13R,14S,17R)-17-[(2R,5R)-5,6-dimethylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol
SGNBVLSWZMBQTH-PODYLUTMSA-N
C[C@H](CC[C@@H](C)C(C)C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H](C4)O)C)C