Methyl 1H-indazole-5-carboxylate is a research compound featuring an indazole core with a methyl ester substituent. It is used primarily in laboratory settings for chemical and pharmaceutical research.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 473416-12-5
Methyl 1h-indazole-6-carboxylate
research compound
3,5-DIBROMO-2-FLUOROPYRIDINE
research compound
Ethyltriphenylphosphonium iodide
research reagent
Pentylboronic acid
boronic acid research reagent
1-azabicyclo[3.2.2]nonan-3-one
research compound
methyl 1H-indazole-5-carboxylate
LPLOEZPPYOSNEW-UHFFFAOYSA-N
COC(=O)C1=CC2=C(C=C1)NN=C2