4-Hydroxypyridine-d5 is a deuterated research reagent where all five hydrogen atoms on the pyridine ring and hydroxyl group are replaced with deuterium. It is commonly used as an internal standard in analytical chemistry and metabolic studies due to its isotopic labeling.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 45503-33-1
LITHIUM-P-STYRENESULFONATE
Ion exchange monomer research
4-(Aminomethyl)pyrimidine
research compound
Benzenediazonium, 3-chloro-, tetrafluoroborate(1-)
diazonium salt for synthesis
3-Fluorobenzyl alcohol
research compound
4-HYDROXYPYRIDINE
Chemical intermediate for synthesis
2,3,5,6-tetradeuterio-4-deuteriooxypyridine
GCNTZFIIOFTKIY-HXRFYODMSA-N
[2H]C1=C(N=C(C(=C1O[2H])[2H])[2H])[2H]