3-(Trifluoromethyl)benzaldehyde is a chemical compound used as a pharmaceutical intermediate. It features a benzaldehyde core with a trifluoromethyl substituent, contributing to its role in organic synthesis.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 454-89-7
3-(Trifluoromethyl)benzoic acid
pharmaceutical intermediate
(4R)-2,2-Dioxido-4-methyl-1,2,3-oxathiazolidine,N-BOC protected
pharmaceutical intermediate
N-Benzoyl-2'-deoxyadenosine
pharmaceutical intermediate for nucleoside synthesis
Tert-butyl 3-(methylamino)pyrrolidine-1-carboxylate
pharmaceutical intermediate for synthesis
3-(trifluoromethyl)benzaldehyde
NMTUHPSKJJYGML-UHFFFAOYSA-N
C1=CC(=CC(=C1)C(F)(F)F)C=O