4-Fluoro-3-propylbenzoic acid is a fluorinated benzoic acid derivative used as a research compound. Its structure features a carboxylic acid group, an aromatic ring, and a fluorine atom, contributing to its properties as a laboratory reagent.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
4-Fluoro-3-propylbenzoic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
3-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
Boronic ester for Suzuki coupling
1,4-Dihydro-1,4-methanonaphthalene
research compound
3-(difluoromethyl)-4-fluoroaniline
research compound
Nicotinamide Riboside Triflate
Research compound for NAD+ metabolism
4-fluoro-3-propylbenzoic acid
CWGCZLDQVNFBMO-UHFFFAOYSA-N
CCCC1=C(C=CC(=C1)C(=O)O)F
4-Fluoro-3-propylbenzoic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.