3-Oleoylestrone-2,4,16,16-D4 is a deuterated steroid compound used as a research standard. It features a steroid backbone with an oleic acid ester moiety and deuterium atoms at specific positions, making it suitable for analytical and investigative studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 443791-75-1
Diethyl (4-isopropyl-3,5-dimethoxybenzyl)phosphonate
Phosphonate building block for synthesis
2-Trifluoromethylphenol
pharmaceutical research reagent
Cyclohexylboronic Acid (contains varying amounts of Anhydride)
Boronic acid reagent for synthesis
(S)-Methyl 3-Amino-3-(4-methoxyphenyl)-propanoate Hydrochloride
research reagent
Climopax
conjugated estrogen active ingredient
(2,4,16,16-tetradeuterio-13-methyl-17-oxo-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-yl) (Z)-octadec-9-enoate
IMIPDPVHGGHVNH-IXTWWMPWSA-N
[2H]C1=CC2=C(CCC3C2CCC4(C3CC(C4=O)([2H])[2H])C)C(=C1OC(=O)CCCCCCC/C=C\CCCCCCCC)[2H]