(2-Benzimidazolyl)acetonitrile is a chemical compound used primarily as an intermediate in the manufacture of fluorescent solvent dyes. Its structure includes a benzimidazole ring and a nitrile group, contributing to its role in dye synthesis.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 4414-88-4
1,2,3,4-Cyclobutanetetracarboxylic dianhydride
precursor for polyimide synthesis
2,2'-Azobis(2,4-dimethylvaleronitrile)
Free radical polymerization initiator
(3-Mercaptopropyl)trimethoxysilane
Silane coupling agent for sealants
Methyl 2,4-dichloropyridine-3-carboxylate
chemical synthesis intermediate
2-(1H-benzimidazol-2-yl)acetonitrile
BWOVACANEIVHST-UHFFFAOYSA-N
C1=CC=C2C(=C1)NC(=N2)CC#N