5-Formyltetrahydropteroic acid is a chemical compound used as a pharmaceutical intermediate in the synthesis of folate analogs. It serves as a key building block in the research and manufacturing of compounds related to folic acid metabolism.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
5-Formyltetrahydropteroic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Folinic acid
pharmaceutical active ingredient
Levoleucovorin
pharmaceutical intermediate
2-Bromomethyl-1,3-dioxolane
Pharmaceutical intermediate
5-Bromo-2-(trifluoromethyl)pyridine
Pharmaceutical intermediate
2-fluoro-1-methyl-3-nitrobenzene
Pharmaceutical intermediate
(2S,3R)-2-Amino-3-(tert-butoxy)butanoic acid
O-tert-butyl protected threonine derivative
4-[[[(6S)-2-Amino-5-formyl-3,4,5,6,7,8-hexahydro-4-oxo-6-pteridinyl]methyl]amino]benzoic acid
research compound
Leucovorin calcium pentahydrate
pharmaceutical raw material
4-[(2-amino-5-formyl-4-oxo-3,6,7,8-tetrahydropteridin-6-yl)methylamino]benzoic acid
CQQLECJFFZOOBZ-UHFFFAOYSA-N
C1C(N(C2=C(N1)N=C(NC2=O)N)C=O)CNC3=CC=C(C=C3)C(=O)O
5-Formyltetrahydropteroic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.