Decafluorobiphenyl is a highly fluorinated biphenyl derivative widely employed as a research intermediate in organic synthesis. Its perfluorinated aromatic rings contribute to unique chemical stability and physical properties, making it valuable in the development of advanced fluorinated materials and building blocks.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Decafluorobiphenyl 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
(Oxybis(2,1-phenylene))bis(dicyclohexylphosphine)
ligand for transition metal catalysis
5-Formyl-2-thiopheneboronic acid
research reagent
3-Bromo-5-(trifluoromethyl)pyridine
chemical research intermediate
5-fluorothiophene-2-carboxylic acid
Research compound
Decafluorobiphenyl(CAS 434-90-2)의 국제 HS 코드는 2903.99입니다.
2903.99
2903 99 80
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
1,2,3,4,5-pentafluoro-6-(2,3,4,5,6-pentafluorophenyl)benzene
ONUFSRWQCKNVSL-UHFFFAOYSA-N
C1(=C(C(=C(C(=C1F)F)F)F)F)C2=C(C(=C(C(=C2F)F)F)F)F
Decafluorobiphenyl 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.