Decafluorobiphenyl is a highly fluorinated biphenyl derivative widely employed as a research intermediate in organic synthesis. Its perfluorinated aromatic rings contribute to unique chemical stability and physical properties, making it valuable in the development of advanced fluorinated materials and building blocks.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 434-90-2
(Oxybis(2,1-phenylene))bis(dicyclohexylphosphine)
ligand for transition metal catalysis
5-Formyl-2-thiopheneboronic acid
research reagent
3-Bromo-5-(trifluoromethyl)pyridine
chemical research intermediate
5-fluorothiophene-2-carboxylic acid
Research compound
1,2,3,4,5-pentafluoro-6-(2,3,4,5,6-pentafluorophenyl)benzene
ONUFSRWQCKNVSL-UHFFFAOYSA-N
C1(=C(C(=C(C(=C1F)F)F)F)F)C2=C(C(=C(C(=C2F)F)F)F)F