This compound is a pharmaceutical intermediate primarily used in peptide synthesis. It features a complex molecular structure with multiple aromatic rings and ether linkages, characteristic of protected amino acid derivatives.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
2-[4-[(2,4-Dimethoxyphenyl)[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]methyl]phenoxy]acetic acid
Fmoc-protected amino acid linker
Fmoc-AEEA-AEEA
peptide synthesis intermediate
(4R)-5-(tert-butoxy)-4-{[(tert-butoxy)carbonyl]amino}-5-oxopentanoic acid
peptide synthesis intermediate
L-Asparagine, N2-[(1,1-dimethylethoxy)carbonyl]-
peptide synthesis intermediate
(5S,8S,11S,12R)-11-((S)-sec-butyl)-1-(9H-fluoren-9-yl)-5,8-diisopropyl-12-methoxy-4,10-dimethyl-3,6,9-trioxo-2-oxa-4,7,10-triazatetradecan-14-oic acid
peptide synthesis intermediate
2-cyanoethyl 3-aminocrotonate
Pharmaceutical intermediate
2-[4-(trifluoromethoxy)phenyl]acetic acid
pharmaceutical intermediate
6-chloro-3-methylpyrimidine-2,4(1H,3H)-dione
Pharmaceutical intermediate for alogliptin and trelagliptin
9H-fluoren-9-ylmethyl N-[[4-[2-[bis(4-methylphenyl)methylamino]-2-oxoethoxy]phenyl]-(2,4-dimethoxyphenyl)methyl]carbamate
JDDWRLPTKIOUOF-UHFFFAOYSA-N
CC1=CC=C(C=C1)C(C2=CC=C(C=C2)C)NC(=O)COC3=CC=C(C=C3)C(C4=C(C=C(C=C4)OC)OC)NC(=O)OCC5C6=CC=CC=C6C7=CC=CC=C57
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.